Products 51099-68-4

CAS 51099-68-4 is the registry number for 3-[(1-Ethyl-1h-benzimidazol-2-yl)thio]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(1-ethylbenzimidazol-2-yl)sulfanylpropanoic acid (CAS 51099-68-4) is a chemical compound with the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. IUPAC name: 3-(1-ethylbenzimidazol-2-yl)sulfanylpropanoic acid. InChIKey: BTPUORIJGQSIMG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N2O2S
Molecular weight250.32 g/mol
IUPAC name3-(1-ethylbenzimidazol-2-yl)sulfanylpropanoic acid
InChIKeyBTPUORIJGQSIMG-UHFFFAOYSA-N
SMILESCCN1C2=CC=CC=C2N=C1SCCC(=O)O

Computed by PubChem (NCBI)