CAS 89631-75-4 is the registry number for N-Boc-4-isothiocyanatoaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Tert-butyl N-(4-isothiocyanatophenyl)carbamate (CAS 89631-75-4) is a chemical compound with the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. IUPAC name: tert-butyl N-(4-isothiocyanatophenyl)carbamate. InChIKey: KMOFDGFIFPIQCT-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2S |
|---|---|
| Molecular weight | 250.32 g/mol |
| IUPAC name | tert-butyl N-(4-isothiocyanatophenyl)carbamate |
| InChIKey | KMOFDGFIFPIQCT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)N=C=S |
Computed by PubChem (NCBI)