CAS 1707392-17-3 is the registry number for 4-(tert-Butyl)-2-(1h-pyrrol-1-yl)thiazole-5-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-tert-butyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylic acid (CAS 1707392-17-3) is a chemical compound with the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. IUPAC name: 4-tert-butyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylic acid. InChIKey: VKZQUUPBDLIHKT-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2S |
|---|---|
| Molecular weight | 250.32 g/mol |
| IUPAC name | 4-tert-butyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | VKZQUUPBDLIHKT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(SC(=N1)N2C=CC=C2)C(=O)O |
Computed by PubChem (NCBI)