Products 1707392-17-3

CAS 1707392-17-3 is the registry number for 4-(tert-Butyl)-2-(1h-pyrrol-1-yl)thiazole-5-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

4-tert-butyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylic acid (CAS 1707392-17-3) is a chemical compound with the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. IUPAC name: 4-tert-butyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylic acid. InChIKey: VKZQUUPBDLIHKT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N2O2S
Molecular weight250.32 g/mol
IUPAC name4-tert-butyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylic acid
InChIKeyVKZQUUPBDLIHKT-UHFFFAOYSA-N
SMILESCC(C)(C)C1=C(SC(=N1)N2C=CC=C2)C(=O)O

Computed by PubChem (NCBI)