CAS 929007-72-7 appears in our catalog under these names: DB07268, DB07268/ 98.21% (existing batch purity), DB07268 98%, DB07268, 98%, 98%, DB07268, 99.49%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg, 2mg, 25mg.
2-[[2-(3-hydroxyanilino)pyrimidin-4-yl]amino]benzamide (CAS 929007-72-7) is a chemical compound with the molecular formula C17H15N5O2 and a molecular weight of 321.33 g/mol. IUPAC name: 2-[[2-(3-hydroxyanilino)pyrimidin-4-yl]amino]benzamide. InChIKey: QHPKKGUGRGRSGA-UHFFFAOYSA-N.
| Molecular formula | C17H15N5O2 |
|---|---|
| Molecular weight | 321.33 g/mol |
| IUPAC name | 2-[[2-(3-hydroxyanilino)pyrimidin-4-yl]amino]benzamide |
| InChIKey | QHPKKGUGRGRSGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)N)NC2=NC(=NC=C2)NC3=CC(=CC=C3)O |
Computed by PubChem (NCBI)