cas: 1384870-47-6 — see every product listed under this CAS number, including other names
DBCO NHS ester, 95% (CAS 1384870-47-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 1g, 5g. Offered by: Lumiprobe.
| brand | Lumiprobe |
|---|---|
| catalog number | LP-x4720-10mg |
| cas | 1384870-47-6 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Lumiprobe | 10mg | 406.70 Pln | |
| Lumiprobe | 25mg | 586.78 Pln | |
| Lumiprobe | 50mg | 844.03 Pln | |
| Lumiprobe | 100mg | 1178.45 Pln | |
| Lumiprobe | 1g | 6122.55 Pln | |
| Lumiprobe | 5g | 17338.65 Pln |
| purity | 95% |
|---|---|
| delivery time | 2 weeks |
(2,5-dioxopyrrolidin-1-yl) 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoate (CAS 1384870-47-6) is a chemical compound with the molecular formula C25H22N2O5 and a molecular weight of 430.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoate. InChIKey: CATTUKBAYDNTEG-UHFFFAOYSA-N.
| Molecular formula | C25H22N2O5 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoate |
| InChIKey | CATTUKBAYDNTEG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42 |
Computed by PubChem (NCBI)