cas: 1384870-47-6 — see every product listed under this CAS number, including other names
DBCO-NHS ester 2, 95% (CAS 1384870-47-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A756218-100mg |
| cas | 1384870-47-6 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 665.19 Pln | |
| Ambeed | 250mg | 1227.00 Pln | |
| Ambeed | 1g | 3446.44 Pln | |
| Ambeed | 5g | 11884.75 Pln | |
| Fluorochem | 1g | 3434.22 Pln | |
| Fluorochem | 5g | 11941.65 Pln | |
| Fluorochem | 100mg | 669.57 Pln | |
| Fluorochem | 250mg | 1231.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2,5-dioxopyrrolidin-1-yl) 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoate (CAS 1384870-47-6) is a chemical compound with the molecular formula C25H22N2O5 and a molecular weight of 430.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoate. InChIKey: CATTUKBAYDNTEG-UHFFFAOYSA-N.
| Molecular formula | C25H22N2O5 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoate |
| InChIKey | CATTUKBAYDNTEG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42 |
Computed by PubChem (NCBI)