cas: 1255942-06-3 — see every product listed under this CAS number, including other names
DBCO-amine, 98% (CAS 1255942-06-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F861617-50MG |
| cas | 1255942-06-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 357.18 Pln | |
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 778.91 Pln | |
| Fluorochem | 500mg | 1346.42 Pln | |
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 5g | 5376.25 Pln | |
| Fluorochem | 10g | 10697.29 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)propan-1-one (CAS 1255942-06-3) is a chemical compound with the molecular formula C18H16N2O and a molecular weight of 276.3 g/mol. IUPAC name: 3-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)propan-1-one. InChIKey: OCCYFTDHSHTFER-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 3-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)propan-1-one |
| InChIKey | OCCYFTDHSHTFER-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCN |
Computed by PubChem (NCBI)