cas: 1255942-06-3 — see every product listed under this CAS number, including other names
Dibenzocyclooctyne-amine, >95.0%(HPLC) (CAS 1255942-06-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2763-25MG |
| cas | 1255942-06-3 |
| size | 25mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25mg | 606.64 Pln | |
| TCI | 100mg | 2086.73 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(HPLC) |
3-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)propan-1-one (CAS 1255942-06-3) is a chemical compound with the molecular formula C18H16N2O and a molecular weight of 276.3 g/mol. IUPAC name: 3-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)propan-1-one. InChIKey: OCCYFTDHSHTFER-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 3-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)propan-1-one |
| InChIKey | OCCYFTDHSHTFER-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCN |
Computed by PubChem (NCBI)