Products 2380228-45-3
CAS 2380228-45-3 appears in our catalog under these names: DC-TEADin02/ 98.82% (existing batch purity), DC–TEADin02, DC-TEADin02, 98.45%, DC-TEADin02, 99%, 99%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 50 mg.
N-[4-(naphthalen-2-ylmethyl)phenyl]ethenesulfonamide (CAS 2380228-45-3) is a chemical compound with the molecular formula C19H17NO2S and a molecular weight of 323.4 g/mol. IUPAC name: N-[4-(naphthalen-2-ylmethyl)phenyl]ethenesulfonamide. InChIKey: IUZGUIPYVGPQFT-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2S |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | N-[4-(naphthalen-2-ylmethyl)phenyl]ethenesulfonamide |
| InChIKey | IUZGUIPYVGPQFT-UHFFFAOYSA-N |
| SMILES | C=CS(=O)(=O)NC1=CC=C(C=C1)CC2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)