Products 1148125-93-2
CAS 1148125-93-2 appears in our catalog under these names: DHODH–IN–4, DHODH-IN-4/ 98.65% (existing batch purity), DHODH-IN-4. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(Z)-N-[2-chloro-4-(2-chlorophenyl)phenyl]-2-cyano-3-hydroxybut-2-enamide (CAS 1148125-93-2) is a chemical compound with the molecular formula C17H12Cl2N2O2 and a molecular weight of 347.2 g/mol. IUPAC name: (Z)-N-[2-chloro-4-(2-chlorophenyl)phenyl]-2-cyano-3-hydroxybut-2-enamide. InChIKey: KEZXIYKJTYTGOO-RAXLEYEMSA-N.
| Molecular formula | C17H12Cl2N2O2 |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | (Z)-N-[2-chloro-4-(2-chlorophenyl)phenyl]-2-cyano-3-hydroxybut-2-enamide |
| InChIKey | KEZXIYKJTYTGOO-RAXLEYEMSA-N |
| SMILES | C/C(=C(\C#N)/C(=O)NC1=C(C=C(C=C1)C2=CC=CC=C2Cl)Cl)/O |
Computed by PubChem (NCBI)