cas: 24424-99-5 — see every product listed under this CAS number, including other names
DI-TERT-BUTYL DICARBONATE, REAGENTPLUS, (CAS 24424-99-5) is a chemical reagent available from Chemat. Available pack sizes: 100G, 10G, 1KG, 50G, 25G, 5G. Offered by: Sigma-Aldrich.
| brand | Sigma-Aldrich |
|---|---|
| catalog number | 205249-100G |
| cas | 24424-99-5 |
| size | 100G |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Sigma-Aldrich | 100G | 1490.00 Pln | |
| Sigma-Aldrich | 10G | 321.00 Pln | |
| Sigma-Aldrich | 1KG | 9390.00 Pln | |
| Sigma-Aldrich | 50G | 900.00 Pln | |
| Sigma-Aldrich | 25G | 676.00 Pln | |
| Sigma-Aldrich | 5G | 225.00 Pln |
| purity | No data |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate (CAS 24424-99-5) is a chemical compound with the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. IUPAC name: tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate. InChIKey: DYHSDKLCOJIUFX-UHFFFAOYSA-N.
| Molecular formula | C10H18O5 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| InChIKey | DYHSDKLCOJIUFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)