cas: 24424-99-5 — see every product listed under this CAS number, including other names
Di-tert-butyl dicarbonate, 99.77% (CAS 24424-99-5) is a chemical reagent available from Chemat. Available pack sizes: 500 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-Y1353-500 g |
| cas | 24424-99-5 |
| size | 500 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 g | 305.76 Pln | |
| MedChemExpress | 100 g | 240.74 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.77% |
Tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate (CAS 24424-99-5) is a chemical compound with the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. IUPAC name: tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate. InChIKey: DYHSDKLCOJIUFX-UHFFFAOYSA-N.
| Molecular formula | C10H18O5 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| InChIKey | DYHSDKLCOJIUFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)