cas: 24424-99-5 — see every product listed under this CAS number, including other names
Di-tert-butyl dicarbonate, 99% (CAS 24424-99-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 500g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 194670100 |
| cas | 24424-99-5 |
| size | 10g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 10g | 208.47 Pln | |
| Thermo Scientific (Acros) | 25g | 391.99 Pln | |
| Thermo Scientific (Acros) | 50g | 601.35 Pln | |
| Thermo Scientific (Acros) | 100g | 886.44 Pln | |
| Thermo Scientific (Acros) | 500g | 3946.64 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
Tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate (CAS 24424-99-5) is a chemical compound with the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. IUPAC name: tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate. InChIKey: DYHSDKLCOJIUFX-UHFFFAOYSA-N.
| Molecular formula | C10H18O5 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| InChIKey | DYHSDKLCOJIUFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)