cas: 24424-99-5 — see every product listed under this CAS number, including other names
Di-tert-butyl Dicarbonate (ca. 30% in Toluene) (CAS 24424-99-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 400g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3880-100G |
| cas | 24424-99-5 |
| size | 100g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100g | 380.45 Pln | |
| TCI | 400g | 788.58 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
Tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate (CAS 24424-99-5) is a chemical compound with the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. IUPAC name: tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate. InChIKey: DYHSDKLCOJIUFX-UHFFFAOYSA-N.
| Molecular formula | C10H18O5 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| InChIKey | DYHSDKLCOJIUFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)