cas: 318-98-9 — see every product listed under this CAS number, including other names
DL-Propranolol hydrochloride, 99% (CAS 318-98-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 207320050 |
| cas | 318-98-9 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 345.67 Pln | |
| Thermo Scientific (Acros) | 25g | 1113.61 Pln | |
| Thermo Scientific (Acros) | 100g | 3109.21 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride (CAS 318-98-9) is a chemical compound with the molecular formula C16H22ClNO2 and a molecular weight of 295.80 g/mol. IUPAC name: 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride. InChIKey: ZMRUPTIKESYGQW-UHFFFAOYSA-N.
| Molecular formula | C16H22ClNO2 |
|---|---|
| Molecular weight | 295.80 g/mol |
| IUPAC name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| InChIKey | ZMRUPTIKESYGQW-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O.Cl |
Computed by PubChem (NCBI)