cas: 318-98-9 — see every product listed under this CAS number, including other names
Propranolol (hydrochloride), 99.97% (CAS 318-98-9) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 10mM/1mL, 100 mg, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-B0573-1 g |
| cas | 318-98-9 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 816.60 Pln | |
| MedChemExpress | 10mM/1mL | 537.96 Pln | |
| MedChemExpress | 100 mg | 500.81 Pln | |
| MedChemExpress | 500 mg | 691.21 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.97% |
1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride (CAS 318-98-9) is a chemical compound with the molecular formula C16H22ClNO2 and a molecular weight of 295.80 g/mol. IUPAC name: 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride. InChIKey: ZMRUPTIKESYGQW-UHFFFAOYSA-N.
| Molecular formula | C16H22ClNO2 |
|---|---|
| Molecular weight | 295.80 g/mol |
| IUPAC name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| InChIKey | ZMRUPTIKESYGQW-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O.Cl |
Computed by PubChem (NCBI)