CAS 2306178-56-1 appears in our catalog under these names: DMX-5804/ 99.63% (existing batch purity), DMX–5804, DMX 5804, DMX-5804 99%, DMX-5084, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
5-[4-(2-methoxyethoxy)phenyl]-7-phenyl-3H-pyrrolo[2,3-d]pyrimidin-4-one (CAS 2306178-56-1) is a chemical compound with the molecular formula C21H19N3O3 and a molecular weight of 361.4 g/mol. IUPAC name: 5-[4-(2-methoxyethoxy)phenyl]-7-phenyl-3H-pyrrolo[2,3-d]pyrimidin-4-one. InChIKey: FUSHFOGORKZNNQ-UHFFFAOYSA-N.
| Molecular formula | C21H19N3O3 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 5-[4-(2-methoxyethoxy)phenyl]-7-phenyl-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| InChIKey | FUSHFOGORKZNNQ-UHFFFAOYSA-N |
| SMILES | COCCOC1=CC=C(C=C1)C2=CN(C3=C2C(=O)NC=N3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)