Products 130848-06-5
CAS 130848-06-5 appears in our catalog under these names: Decursinol angelate, Decursinol angelate/ 99.65% (existing batch purity), Decursinol angelate, Decursinol angelate - Bio-X â„¢, Decursinol angelate, 99.93% ,, 99.93% ,. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1mg, 100mg, 500mg, 250mg.
[(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (Z)-2-methylbut-2-enoate (CAS 130848-06-5) is a chemical compound with the molecular formula C19H20O5 and a molecular weight of 328.4 g/mol. IUPAC name: [(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (Z)-2-methylbut-2-enoate. InChIKey: AGABNGOXUSXQDD-XKGFZTIGSA-N.
| Molecular formula | C19H20O5 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | [(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (Z)-2-methylbut-2-enoate |
| InChIKey | AGABNGOXUSXQDD-XKGFZTIGSA-N |
| SMILES | C/C=C(/C)\C(=O)O[C@H]1CC2=C(C=C3C(=C2)C=CC(=O)O3)OC1(C)C |
Computed by PubChem (NCBI)