CAS 113527-39-2 appears in our catalog under these names: 2-(Naphthalen-1-ylmethyl)-2-((tetrahydrofuran-2-yl)methyl)malonic acid, 95+%, 1-(Tetrahydro-2-furyl)-3-(1-naphthyl)propane-2,2-dicarboxylic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-(naphthalen-1-ylmethyl)-2-(oxolan-2-ylmethyl)propanedioic acid (CAS 113527-39-2) is a chemical compound with the molecular formula C19H20O5 and a molecular weight of 328.4 g/mol. IUPAC name: 2-(naphthalen-1-ylmethyl)-2-(oxolan-2-ylmethyl)propanedioic acid. InChIKey: RALQDQYWJRGAQI-UHFFFAOYSA-N.
| Molecular formula | C19H20O5 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 2-(naphthalen-1-ylmethyl)-2-(oxolan-2-ylmethyl)propanedioic acid |
| InChIKey | RALQDQYWJRGAQI-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CC(CC2=CC=CC3=CC=CC=C32)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)