CAS 13209-79-5 appears in our catalog under these names: (S)-2-(7-Oxo-2,3-dihydro-7H-furo[3,2-g]chromen-2-yl)propan-2-yl 3-methylbut-2-enoate, 98%, Marmesin angelate. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 5mg.
2-[(2S)-7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl]propan-2-yl 3-methylbut-2-enoate (CAS 13209-79-5) is a chemical compound with the molecular formula C19H20O5 and a molecular weight of 328.4 g/mol. IUPAC name: 2-[(2S)-7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl]propan-2-yl 3-methylbut-2-enoate. InChIKey: PQCLZBCFLJVBGA-INIZCTEOSA-N.
| Molecular formula | C19H20O5 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 2-[(2S)-7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl]propan-2-yl 3-methylbut-2-enoate |
| InChIKey | PQCLZBCFLJVBGA-INIZCTEOSA-N |
| SMILES | CC(=CC(=O)OC(C)(C)[C@@H]1CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)C |
Computed by PubChem (NCBI)