CAS 664366-06-7 appears in our catalog under these names: (3-tert-Butyl-5,9-dimethyl-7-oxo-7h-furo[3,2-g]chromen-6-yl)acetic acid, 95%, 2-(3-(tert-Butyl)-5,9-dimethyl-7-oxo-7H-furo(3,2-g)chromen-6-yl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetic acid (CAS 664366-06-7) is a chemical compound with the molecular formula C19H20O5 and a molecular weight of 328.4 g/mol. IUPAC name: 2-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetic acid. InChIKey: IZOOUGOSLDMECH-UHFFFAOYSA-N.
| Molecular formula | C19H20O5 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 2-(3-tert-butyl-5,9-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetic acid |
| InChIKey | IZOOUGOSLDMECH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C(C3=C(C=C12)C(=CO3)C(C)(C)C)C)CC(=O)O |
Computed by PubChem (NCBI)