CAS 100753-43-3 is the registry number for 1-(2,4-Dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1-(2,4-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one (CAS 100753-43-3) is a chemical compound with the molecular formula C19H20O5 and a molecular weight of 328.4 g/mol. IUPAC name: (E)-1-(2,4-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one. InChIKey: XKVLLUWABVOODQ-WEVVVXLNSA-N.
| Molecular formula | C19H20O5 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | (E)-1-(2,4-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| InChIKey | XKVLLUWABVOODQ-WEVVVXLNSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)/C=C/C2=CC(=C(C=C2)OC)OC)OC |
Computed by PubChem (NCBI)