CAS 137319-34-7 appears in our catalog under these names: Dehydroeffusol/ 99.35% (existing batch purity), Dehydroeffusol 99%, 5-Ethenyl-1-methyl-2,7-phenanthrenediol, 99%, 99%, Dehydroeffusol, 99.55%. Offered by: TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 10 mg.
5-ethenyl-1-methylphenanthrene-2,7-diol (CAS 137319-34-7) is a chemical compound with the molecular formula C17H14O2 and a molecular weight of 250.29 g/mol. IUPAC name: 5-ethenyl-1-methylphenanthrene-2,7-diol. InChIKey: GSSPKCPIRDPBQE-UHFFFAOYSA-N.
| Molecular formula | C17H14O2 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 5-ethenyl-1-methylphenanthrene-2,7-diol |
| InChIKey | GSSPKCPIRDPBQE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C=CC3=CC(=CC(=C32)C=C)O)O |
Computed by PubChem (NCBI)