CAS 84408-37-7 appears in our catalog under these names: Desciclovir, 98%, Desciclovir/ 99.54% (existing batch purity), Desciclovir, Desciclovir 98%, 2-((2-Amino-9H-purin-9-yl)methoxy)ethan-1-ol, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[(2-aminopurin-9-yl)methoxy]ethanol (CAS 84408-37-7) is a chemical compound with the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. IUPAC name: 2-[(2-aminopurin-9-yl)methoxy]ethanol. InChIKey: OKQHSIGMOWQUIK-UHFFFAOYSA-N.
| Molecular formula | C8H11N5O2 |
|---|---|
| Molecular weight | 209.21 g/mol |
| IUPAC name | 2-[(2-aminopurin-9-yl)methoxy]ethanol |
| InChIKey | OKQHSIGMOWQUIK-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=N1)N)N(C=N2)COCCO |
Computed by PubChem (NCBI)