cas: 4957-14-6 — see every product listed under this CAS number, including other names
Di-p-tolylmethane, 99%+(GC-MS),RG, 99%+(GC-MS),RG (CAS 4957-14-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PQM-1g |
| cas | 4957-14-6 |
| size | 1g |
| availability | 55g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 894.80 Pln |
| purity | 99%+(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
1-methyl-4-[(4-methylphenyl)methyl]benzene (CAS 4957-14-6) is a chemical compound with the molecular formula C15H16 and a molecular weight of 196.29 g/mol. IUPAC name: 1-methyl-4-[(4-methylphenyl)methyl]benzene. InChIKey: HZAWPPRBCALFRN-UHFFFAOYSA-N.
| Molecular formula | C15H16 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | 1-methyl-4-[(4-methylphenyl)methyl]benzene |
| InChIKey | HZAWPPRBCALFRN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)