CAS 3976-35-0 appears in our catalog under these names: 2,4,6-Trimethylbiphenyl, 95-<97%, 1,3,5-Trimethyl-2-phenylbenzene, 95%. Offered by: Hoffman Fine Chemicals, AmBeed. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
1,3,5-trimethyl-2-phenylbenzene (CAS 3976-35-0) is a chemical compound with the molecular formula C15H16 and a molecular weight of 196.29 g/mol. IUPAC name: 1,3,5-trimethyl-2-phenylbenzene. InChIKey: CDKUYUULLQLNFF-UHFFFAOYSA-N.
| Molecular formula | C15H16 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | 1,3,5-trimethyl-2-phenylbenzene |
| InChIKey | CDKUYUULLQLNFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)