CAS 3717-68-8 is the registry number for 1-Methyl-4-(1-phenylethyl)benzene, 90%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g.
1-methyl-4-(1-phenylethyl)benzene (CAS 3717-68-8) is a chemical compound with the molecular formula C15H16 and a molecular weight of 196.29 g/mol. IUPAC name: 1-methyl-4-(1-phenylethyl)benzene. InChIKey: BOKDBSJFKVOFBS-UHFFFAOYSA-N.
| Molecular formula | C15H16 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | 1-methyl-4-(1-phenylethyl)benzene |
| InChIKey | BOKDBSJFKVOFBS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)