cas: 20880-92-6 — see every product listed under this CAS number, including other names
Diacetone-Ăź-D-fructose, 98% (CAS 20880-92-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 250g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494203-25G |
| cas | 20880-92-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 100g | 232.23 Pln | |
| Fluorochem | 250g | 497.76 Pln | |
| Fluorochem | 500g | 846.59 Pln | |
| Fluorochem | 1kg | 1622.36 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol (CAS 20880-92-6) is a chemical compound with the molecular formula C12H20O6 and a molecular weight of 260.28 g/mol. IUPAC name: [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol. InChIKey: PSSHGMIAIUYOJF-XBWDGYHZSA-N.
| Molecular formula | C12H20O6 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol |
| InChIKey | PSSHGMIAIUYOJF-XBWDGYHZSA-N |
| SMILES | CC1(O[C@@H]2CO[C@@]3([C@H]([C@@H]2O1)OC(O3)(C)C)CO)C |
Computed by PubChem (NCBI)