cas: 2222-33-5 — see every product listed under this CAS number, including other names
Dibenzosuberenone, 97% (CAS 2222-33-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 25G, 10g, 1g, 5g, 500g, 1kg. Offered by: Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 112531000 |
| cas | 2222-33-5 |
| size | 100g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 100g | 659.26 Pln | |
| Sigma-Aldrich | 100G | 949.00 Pln | |
| Sigma-Aldrich | 25G | 348.00 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 117.68 Pln | |
| Fluorochem | 100g | 242.64 Pln | |
| Fluorochem | 500g | 924.69 Pln | |
| Fluorochem | 1kg | 1523.44 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
Tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one (CAS 2222-33-5) is a chemical compound with the molecular formula C15H10O and a molecular weight of 206.24 g/mol. IUPAC name: tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one. InChIKey: SNVTZAIYUGUKNI-UHFFFAOYSA-N.
| Molecular formula | C15H10O |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one |
| InChIKey | SNVTZAIYUGUKNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)