CAS 1140-79-0 appears in our catalog under these names: Anthracene-1-carbaldehyde 98%, 1-Anthracenecarboxaldehyde, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Anthracene-1-carbaldehyde (CAS 1140-79-0) is a chemical compound with the molecular formula C15H10O and a molecular weight of 206.24 g/mol. IUPAC name: anthracene-1-carbaldehyde. InChIKey: XJDFBLQCLSBCGQ-UHFFFAOYSA-N.
| Molecular formula | C15H10O |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | anthracene-1-carbaldehyde |
| InChIKey | XJDFBLQCLSBCGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C=CC=C3C=O |
Computed by PubChem (NCBI)