CAS 115021-39-1 appears in our catalog under these names: 3-(Phenylethynyl)benzaldehyde, 99%+,RG, 99%+,RG, 3-(Phenylethynyl)benzaldehyde, 99%+,RG. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
3-(2-phenylethynyl)benzaldehyde (CAS 115021-39-1) is a chemical compound with the molecular formula C15H10O and a molecular weight of 206.24 g/mol. IUPAC name: 3-(2-phenylethynyl)benzaldehyde. InChIKey: RRMQKWJANJYKFC-UHFFFAOYSA-N.
| Molecular formula | C15H10O |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 3-(2-phenylethynyl)benzaldehyde |
| InChIKey | RRMQKWJANJYKFC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)