CAS 119754-17-5 is the registry number for (4-Ethynylphenyl)phenyl-methanone, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(4-ethynylphenyl)-phenylmethanone (CAS 119754-17-5) is a chemical compound with the molecular formula C15H10O and a molecular weight of 206.24 g/mol. IUPAC name: (4-ethynylphenyl)-phenylmethanone. InChIKey: GMJRQKHAIVLPIR-UHFFFAOYSA-N.
| Molecular formula | C15H10O |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | (4-ethynylphenyl)-phenylmethanone |
| InChIKey | GMJRQKHAIVLPIR-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)