Products 2222-33-5
CAS 2222-33-5 appears in our catalog under these names: 5–Dibenzosuberenone, 5-Dibenzosuberenone, 5-Dibenzosuberenone 98%, 5-Dibenzosuberenone, >95% (HPLC), 5-Dibenzosuberenone, 98%, 98%. Offered by: GLPBio, Biosynth, Ambeed, TRC, Chemat. Available pack sizes: 100g, 250g, 2kg, 1kg, 5g, 10g, 25g, 500g.
Tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one (CAS 2222-33-5) is a chemical compound with the molecular formula C15H10O and a molecular weight of 206.24 g/mol. IUPAC name: tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one. InChIKey: SNVTZAIYUGUKNI-UHFFFAOYSA-N.
| Molecular formula | C15H10O |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one |
| InChIKey | SNVTZAIYUGUKNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)
Synonyms:
Dibenzosuberenone, 5-Dibenzosuberenone, 5H-Dibenzo[a,d]cyclohepten-5-one, Dibenzo[a,d]cyclohepten-5-one, 5H-Dibenzo(a,d)cyclohepten-5-one, Dibenzo(a,d)cyclohepten-5-one, 5H-Dibenzo(a,d)cycloheptenone, Dibenzo[b,f]cyclohepten-1-one, 5H-Dibenzo[a,d]cycloheptenone, Dibenzo(b,f)cyclohepten-1-one