cas: 31139-36-3 — see every product listed under this CAS number, including other names
Dibenzyl pyrocarbonate, 97%, 97% (CAS 31139-36-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PBS-250mg |
| cas | 31139-36-3 |
| size | 250mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 386.00 Pln | |
| Chemat | 10g | 698.00 Pln | |
| Chemat | 25g | 1571.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl phenylmethoxycarbonyl carbonate (CAS 31139-36-3) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: benzyl phenylmethoxycarbonyl carbonate. InChIKey: FHRRJZZGSJXPRQ-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | benzyl phenylmethoxycarbonyl carbonate |
| InChIKey | FHRRJZZGSJXPRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)OC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)