cas: 6311-48-4 — see every product listed under this CAS number, including other names
Dibenzylidene 4,4'-Biphenylenediamine, 97% (CAS 6311-48-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F341876-1G |
| cas | 6311-48-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 404.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-[4-[4-(benzylideneamino)phenyl]phenyl]-1-phenylmethanimine (CAS 6311-48-4) is a chemical compound with the molecular formula C26H20N2 and a molecular weight of 360.4 g/mol. IUPAC name: N-[4-[4-(benzylideneamino)phenyl]phenyl]-1-phenylmethanimine. InChIKey: QUDPDXGSAOZKNW-UHFFFAOYSA-N.
| Molecular formula | C26H20N2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | N-[4-[4-(benzylideneamino)phenyl]phenyl]-1-phenylmethanimine |
| InChIKey | QUDPDXGSAOZKNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NC2=CC=C(C=C2)C3=CC=C(C=C3)N=CC4=CC=CC=C4 |
Computed by PubChem (NCBI)