CAS 106704-35-2 appears in our catalog under these names: 4,4'–(Anthracene–9,10–diyl)dianiline, 4,4'-(9,10-Anthracenediyl)bis[benzenamine] 97%, 4,4'-(9,10-Anthracenediyl)bis[benzenamine], 97%, 97%, 4,4'-(Anthracene-9,10-diyl)dianiline, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-[10-(4-aminophenyl)anthracen-9-yl]aniline (CAS 106704-35-2) is a chemical compound with the molecular formula C26H20N2 and a molecular weight of 360.4 g/mol. IUPAC name: 4-[10-(4-aminophenyl)anthracen-9-yl]aniline. InChIKey: ASNOFHCTUSIHOM-UHFFFAOYSA-N.
| Molecular formula | C26H20N2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 4-[10-(4-aminophenyl)anthracen-9-yl]aniline |
| InChIKey | ASNOFHCTUSIHOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C4=CC=C(C=C4)N)C5=CC=C(C=C5)N |
Computed by PubChem (NCBI)