CAS 6311-48-4 appears in our catalog under these names: N,N'-Bisbenzylidenebenzidine, 97%, (N4E,N4'E)-N4,N4'-Dibenzylidene-[1,1'-biphenyl]-4,4'-diamine, 97%, 97%, Dibenzylidene 4,4'-Biphenylenediamine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g.
N-[4-[4-(benzylideneamino)phenyl]phenyl]-1-phenylmethanimine (CAS 6311-48-4) is a chemical compound with the molecular formula C26H20N2 and a molecular weight of 360.4 g/mol. IUPAC name: N-[4-[4-(benzylideneamino)phenyl]phenyl]-1-phenylmethanimine. InChIKey: QUDPDXGSAOZKNW-UHFFFAOYSA-N.
| Molecular formula | C26H20N2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | N-[4-[4-(benzylideneamino)phenyl]phenyl]-1-phenylmethanimine |
| InChIKey | QUDPDXGSAOZKNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NC2=CC=C(C=C2)C3=CC=C(C=C3)N=CC4=CC=CC=C4 |
Computed by PubChem (NCBI)