CAS 23593-74-0 is the registry number for 1-Tritylbenzimidazole, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-tritylbenzimidazole (CAS 23593-74-0) is a chemical compound with the molecular formula C26H20N2 and a molecular weight of 360.4 g/mol. IUPAC name: 1-tritylbenzimidazole. InChIKey: KCENPJPWSWRZLS-UHFFFAOYSA-N.
| Molecular formula | C26H20N2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 1-tritylbenzimidazole |
| InChIKey | KCENPJPWSWRZLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=NC5=CC=CC=C54 |
Computed by PubChem (NCBI)