Products 93-46-9
CAS 93-46-9 appears in our catalog under these names: ASM-DNT, >95% (HPLC), N,N'-Bis-(2-naphthyl)-p-phenylenediamine (DNPD), Diafen NN, N,N'-Di-2-naphthyl-1,4-phenylenediamine, N,N'-Di-2-naphthyl-1,4-phenylenediamine, >95.0%(HPLC). Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Biosynth, TCI. Available pack sizes: 2,5g, 250mg, 500mg, 100mg, 500g, 1kg, 0,5kg, 25g.
1-N,4-N-dinaphthalen-2-ylbenzene-1,4-diamine (CAS 93-46-9) is a chemical compound with the molecular formula C26H20N2 and a molecular weight of 360.4 g/mol. IUPAC name: 1-N,4-N-dinaphthalen-2-ylbenzene-1,4-diamine. InChIKey: VETPHHXZEJAYOB-UHFFFAOYSA-N.
| Molecular formula | C26H20N2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 1-N,4-N-dinaphthalen-2-ylbenzene-1,4-diamine |
| InChIKey | VETPHHXZEJAYOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NC3=CC=C(C=C3)NC4=CC5=CC=CC=C5C=C4 |
Computed by PubChem (NCBI)