cas: 263703-32-8 — see every product listed under this CAS number, including other names
Dicyclohexylamine 2-cyanoacrylate 95% (CAS 263703-32-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A731939-100mg |
| cas | 263703-32-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 2428.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A731939 |
2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine (CAS 263703-32-8) is a chemical compound with the molecular formula C16H26N2O2 and a molecular weight of 278.39 g/mol. IUPAC name: 2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine. InChIKey: KBUNPAIJSVOOSU-UHFFFAOYSA-N.
| Molecular formula | C16H26N2O2 |
|---|---|
| Molecular weight | 278.39 g/mol |
| IUPAC name | 2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine |
| InChIKey | KBUNPAIJSVOOSU-UHFFFAOYSA-N |
| SMILES | C=C(C#N)C(=O)O.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)