cas: 263703-32-8 — see every product listed under this CAS number, including other names
N-Cyclohexylcyclohexanaminium 2-cyanoacrylate, 95%, 95% (CAS 263703-32-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113SXA-100mg |
| cas | 263703-32-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 722.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine (CAS 263703-32-8) is a chemical compound with the molecular formula C16H26N2O2 and a molecular weight of 278.39 g/mol. IUPAC name: 2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine. InChIKey: KBUNPAIJSVOOSU-UHFFFAOYSA-N.
| Molecular formula | C16H26N2O2 |
|---|---|
| Molecular weight | 278.39 g/mol |
| IUPAC name | 2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine |
| InChIKey | KBUNPAIJSVOOSU-UHFFFAOYSA-N |
| SMILES | C=C(C#N)C(=O)O.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)