Diethyl 2-(6-hydroxyhexyl)malonate, 90%
cas: 108051-46-3 — see every product listed under this CAS number, including other names
Diethyl 2-(6-hydroxyhexyl)malonate, 90% (CAS 108051-46-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F865350-100MG |
| cas | 108051-46-3 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 549.82 Pln | |
| Fluorochem | 250mg | 789.32 Pln | |
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 5g | 7198.52 Pln | |
| Ambeed | 100mg | 459.38 Pln | |
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 1527.38 Pln | |
| Ambeed | 5g | 5204.19 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1106.00 Pln | |
| Chemat | 5g | 5118.80 Pln | |
| BLDpharm | 100mg | 458.75 Pln | |
| BLDpharm | 250mg | 647.57 Pln | |
| BLDpharm | 1g | 1508.38 Pln | |
| BLDpharm | 5g | 5101.56 Pln |
properties
| purity | 90% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Diethyl 2-(6-hydroxyhexyl)propanedioate (CAS 108051-46-3) is a chemical compound with the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. IUPAC name: diethyl 2-(6-hydroxyhexyl)propanedioate. InChIKey: GDFPCVYDLNPTRL-UHFFFAOYSA-N.
| Molecular formula | C13H24O5 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | diethyl 2-(6-hydroxyhexyl)propanedioate |
| InChIKey | GDFPCVYDLNPTRL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCCCCCO)C(=O)OCC |
Computed by PubChem (NCBI)