Products 1093652-76-6

CAS 1093652-76-6 is the registry number for 1-(2-Hydroxypropyl)ester Decanedioic Acid. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

10-(2-hydroxypropoxy)-10-oxodecanoic acid (CAS 1093652-76-6) is a chemical compound with the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. IUPAC name: 10-(2-hydroxypropoxy)-10-oxodecanoic acid. InChIKey: WCUNHYXNBCSQFF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24O5
Molecular weight260.33 g/mol
IUPAC name10-(2-hydroxypropoxy)-10-oxodecanoic acid
InChIKeyWCUNHYXNBCSQFF-UHFFFAOYSA-N
SMILESCC(COC(=O)CCCCCCCCC(=O)O)O

Computed by PubChem (NCBI)