Products 71243-33-9

CAS 71243-33-9 is the registry number for 6-Methoxy-6-oxohexyl 6-hydroxyhexanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(6-methoxy-6-oxohexyl) 6-hydroxyhexanoate (CAS 71243-33-9) is a chemical compound with the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. IUPAC name: (6-methoxy-6-oxohexyl) 6-hydroxyhexanoate. InChIKey: QRZKKGGFGAWLMF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24O5
Molecular weight260.33 g/mol
IUPAC name(6-methoxy-6-oxohexyl) 6-hydroxyhexanoate
InChIKeyQRZKKGGFGAWLMF-UHFFFAOYSA-N
SMILESCOC(=O)CCCCCOC(=O)CCCCCO

Computed by PubChem (NCBI)