CAS 407577-54-2 appears in our catalog under these names: Rosuvastatin Impurity 34, tert-Butyl 2-((4R,6R)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl)acetate, 98%, (4R,6R)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic Acid 1,1-Dimethylethyl Ester, >95% (HPLC). Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 2,5mg.
Tert-butyl 2-[(4R,6R)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 407577-54-2) is a chemical compound with the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. IUPAC name: tert-butyl 2-[(4R,6R)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: CFRUAOXMCVQMFP-NXEZZACHSA-N.
| Molecular formula | C13H24O5 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | tert-butyl 2-[(4R,6R)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | CFRUAOXMCVQMFP-NXEZZACHSA-N |
| SMILES | CC1(O[C@H](C[C@@H](O1)CO)CC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)