CAS 124655-09-0 appears in our catalog under these names: Rosuvastatin Impurity 51, Pitavastatin Impurity 36, (4R,6S)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic Acid 1,1-Dimethylethyl Ester, tert–Butyl (4R,6S)–6–(Hydroxymethyl)–2,2–dimethyl–1,3–dioxane–4–acetate, tert-Butyl (4R,6S)-6-(Hydroxymethyl)-2,2-dimethyl-1,3-dioxane-4-acetate, >98.0%(GC). Offered by: Chemat Brand, TRC, GLPBio, TCI, Ambeed. Available pack sizes: on request, 1g, 100g, 10g, 25g, 5g.
Tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 124655-09-0) is a chemical compound with the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. IUPAC name: tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: CFRUAOXMCVQMFP-ZJUUUORDSA-N.
| Molecular formula | C13H24O5 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | CFRUAOXMCVQMFP-ZJUUUORDSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)CO)CC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)