cas: 149771-08-4 — see every product listed under this CAS number, including other names
Diethyl 2-(methylthio)pyrimidine-4,5-dicarboxylate (CAS 149771-08-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237653-250MG |
| cas | 149771-08-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 1091.30 Pln | |
| Fluorochem | 5g | 3595.63 Pln | |
| Fluorochem | 10g | 5673.02 Pln |
| delivery time | 3-4 weeks |
|---|
Diethyl 2-methylsulfanylpyrimidine-4,5-dicarboxylate (CAS 149771-08-4) is a chemical compound with the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. IUPAC name: diethyl 2-methylsulfanylpyrimidine-4,5-dicarboxylate. InChIKey: RVHLRUKDQWAVPR-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | diethyl 2-methylsulfanylpyrimidine-4,5-dicarboxylate |
| InChIKey | RVHLRUKDQWAVPR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1C(=O)OCC)SC |
Computed by PubChem (NCBI)