Products 864685-23-4
CAS 864685-23-4 appears in our catalog under these names: 1-{[(3-nitrophenyl)methane]sulfonyl}pyrrolidine, 97%, 1-((3-Nitrobenzyl)sulfonyl)pyrrolidine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
1-[(3-nitrophenyl)methylsulfonyl]pyrrolidine (CAS 864685-23-4) is a chemical compound with the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. IUPAC name: 1-[(3-nitrophenyl)methylsulfonyl]pyrrolidine. InChIKey: XRCGXTVCSRFBJW-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | 1-[(3-nitrophenyl)methylsulfonyl]pyrrolidine |
| InChIKey | XRCGXTVCSRFBJW-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)CC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)