CAS 1213253-85-0 is the registry number for P-Vinylsulfonamido-(s)-phenylalanine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
(2S)-2-amino-3-[4-(ethenylsulfonylamino)phenyl]propanoic acid (CAS 1213253-85-0) is a chemical compound with the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. IUPAC name: (2S)-2-amino-3-[4-(ethenylsulfonylamino)phenyl]propanoic acid. InChIKey: ZFASEKFUMFQQSX-JTQLQIEISA-N.
| Molecular formula | C11H14N2O4S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(ethenylsulfonylamino)phenyl]propanoic acid |
| InChIKey | ZFASEKFUMFQQSX-JTQLQIEISA-N |
| SMILES | C=CS(=O)(=O)NC1=CC=C(C=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)