CAS 473476-89-0 is the registry number for 1-[(2-Methyl-5-nitrobenzene)sulfonyl]pyrrolidine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
1-(2-methyl-5-nitrophenyl)sulfonylpyrrolidine (CAS 473476-89-0) is a chemical compound with the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. IUPAC name: 1-(2-methyl-5-nitrophenyl)sulfonylpyrrolidine. InChIKey: UAWVQXHNCPBOGA-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | 1-(2-methyl-5-nitrophenyl)sulfonylpyrrolidine |
| InChIKey | UAWVQXHNCPBOGA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)N2CCCC2 |
Computed by PubChem (NCBI)